C30H40F4 — CID 23188588
1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene (PubChem CID 23188588) has the molecular formula C30H40F4 and a molecular weight of 476.64 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene.
| Compound Name | 1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene |
|---|---|
| PubChem CID | 23188588 |
| Molecular Formula | C30H40F4 |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2-tetrafluoropentyl)phenyl]benzene |
| SMILES | CCCCCCCC1CCC(c2ccc(-c3ccc(C(F)(F)C(F)(F)CCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H40F4/c1-3-5-6-7-8-9-23-10-12-24(13-11-23)25-14-16-26(17-15-25)27-18-20-28(21-19-27)30(33,34)29(31,32)22-4-2/h14-21,23-24H,3-13,22H2,1-2H3 |
| InChIKey | APMSXHPOPVFPBM-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|