C27H27F11O — CID 20539009
1-(4-butylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)phenyl]benzene (PubChem CID 20539009) has the molecular formula C27H27F11O and a molecular weight of 576.49 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)phenyl]benzene.
| Compound Name | 1-(4-butylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)phenyl]benzene |
|---|---|
| PubChem CID | 20539009 |
| Molecular Formula | C27H27F11O |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 1-(4-butylcyclohexyl)-4-[4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)phenyl]benzene |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H27F11O/c1-2-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-13-15-22(16-14-21)39-27(37,38)25(32,33)23(28,29)24(30,31)26(34,35)36/h9-18H,2-8H2,1H3 |
| InChIKey | BSJTZGKVBUHRKW-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|