C28H35F5O — CID 20538917
1-(4-octylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene (PubChem CID 20538917) has the molecular formula C28H35F5O and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-(4-octylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene.
| Compound Name | 1-(4-octylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 20538917 |
| Molecular Formula | C28H35F5O |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 1-(4-octylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene |
| SMILES | CCCCCCCCC1CCC(c2ccc(-c3ccc(OC(F)(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H35F5O/c1-2-3-4-5-6-7-8-21-9-11-22(12-10-21)23-13-15-24(16-14-23)25-17-19-26(20-18-25)34-28(32,33)27(29,30)31/h13-22H,2-12H2,1H3 |
| InChIKey | BERKWMYGVRLAOI-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|