C27H33F5O — CID 20538913
1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene (PubChem CID 20538913) has the molecular formula C27H33F5O and a molecular weight of 468.55 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene.
| Compound Name | 1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 20538913 |
| Molecular Formula | C27H33F5O |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]benzene |
| SMILES | CCCCCCCC1CCC(c2ccc(-c3ccc(OC(F)(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H33F5O/c1-2-3-4-5-6-7-20-8-10-21(11-9-20)22-12-14-23(15-13-22)24-16-18-25(19-17-24)33-27(31,32)26(28,29)30/h12-21H,2-11H2,1H3 |
| InChIKey | YNRLHJLMOLKEGG-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|