C23H28F2 — CID 23188567
1-(2,2-difluoropropyl)-4-[4-(4-ethylcyclohexyl)phenyl]benzene (PubChem CID 23188567) has the molecular formula C23H28F2 and a molecular weight of 342.47 g/mol. Its IUPAC name is 1-(2,2-difluoropropyl)-4-[4-(4-ethylcyclohexyl)phenyl]benzene.
| Compound Name | 1-(2,2-difluoropropyl)-4-[4-(4-ethylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 23188567 |
| Molecular Formula | C23H28F2 |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-(2,2-difluoropropyl)-4-[4-(4-ethylcyclohexyl)phenyl]benzene |
| SMILES | CCC1CCC(c2ccc(-c3ccc(CC(C)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H28F2/c1-3-17-4-8-19(9-5-17)21-12-14-22(15-13-21)20-10-6-18(7-11-20)16-23(2,24)25/h6-7,10-15,17,19H,3-5,8-9,16H2,1-2H3 |
| InChIKey | QDSMGWBTJYSELQ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |