C25H34 — CID 145009719
1-ethenyl-4-[4-(4-ethylcyclohexyl)phenyl]benzene;propane (PubChem CID 145009719) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-ethenyl-4-[4-(4-ethylcyclohexyl)phenyl]benzene;propane.
| Compound Name | 1-ethenyl-4-[4-(4-ethylcyclohexyl)phenyl]benzene;propane |
|---|---|
| PubChem CID | 145009719 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 1-ethenyl-4-[4-(4-ethylcyclohexyl)phenyl]benzene;propane |
| SMILES | C=Cc1ccc(-c2ccc(C3CCC(CC)CC3)cc2)cc1.CCC |
| InChI | InChI=1S/C22H26.C3H8/c1-3-17-5-9-19(10-6-17)21-13-15-22(16-14-21)20-11-7-18(4-2)8-12-20;1-3-2/h3,5-6,9-10,13-16,18,20H,1,4,7-8,11-12H2,2H3;3H2,1-2H3 |
| InChIKey | VURUOLYJINAMIS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |