C14H17F3 — CID 169171689
1-(3-ethylcyclobutyl)-4-(2,2,2-trifluoroethyl)benzene (PubChem CID 169171689) has the molecular formula C14H17F3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-(3-ethylcyclobutyl)-4-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 1-(3-ethylcyclobutyl)-4-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 169171689 |
| Molecular Formula | C14H17F3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-(3-ethylcyclobutyl)-4-(2,2,2-trifluoroethyl)benzene |
| SMILES | CCC1CC(c2ccc(CC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H17F3/c1-2-10-7-13(8-10)12-5-3-11(4-6-12)9-14(15,16)17/h3-6,10,13H,2,7-9H2,1H3 |
| InChIKey | LEOILCCAHHKRKO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |