C22H25F3O — CID 67779004
1-(4-ethylcyclohexyl)-4-[[4-(trifluoromethyl)phenyl]methoxy]benzene (PubChem CID 67779004) has the molecular formula C22H25F3O and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-4-[[4-(trifluoromethyl)phenyl]methoxy]benzene.
| Compound Name | 1-(4-ethylcyclohexyl)-4-[[4-(trifluoromethyl)phenyl]methoxy]benzene |
|---|---|
| PubChem CID | 67779004 |
| Molecular Formula | C22H25F3O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-4-[[4-(trifluoromethyl)phenyl]methoxy]benzene |
| SMILES | CCC1CCC(c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H25F3O/c1-2-16-3-7-18(8-4-16)19-9-13-21(14-10-19)26-15-17-5-11-20(12-6-17)22(23,24)25/h5-6,9-14,16,18H,2-4,7-8,15H2,1H3 |
| InChIKey | JACVTJVBLFIDHV-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |