C22H27F5OS — CID 88523486
pentafluoro-[4-[[4-(4-propylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane (PubChem CID 88523486) has the molecular formula C22H27F5OS and a molecular weight of 434.51 g/mol. Its IUPAC name is pentafluoro-[4-[[4-(4-propylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-[[4-(4-propylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 88523486 |
| Molecular Formula | C22H27F5OS |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | pentafluoro-[4-[[4-(4-propylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane |
| SMILES | CCCC1CCC(c2ccc(COc3ccc(S(F)(F)(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H27F5OS/c1-2-3-17-4-8-19(9-5-17)20-10-6-18(7-11-20)16-28-21-12-14-22(15-13-21)29(23,24,25,26)27/h6-7,10-15,17,19H,2-5,8-9,16H2,1H3 |
| InChIKey | VEDLOUNLGAXSGX-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |