C27H37F5OS — CID 88523413
pentafluoro-[4-[[4-(4-octylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane (PubChem CID 88523413) has the molecular formula C27H37F5OS and a molecular weight of 504.65 g/mol. Its IUPAC name is pentafluoro-[4-[[4-(4-octylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-[[4-(4-octylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 88523413 |
| Molecular Formula | C27H37F5OS |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | pentafluoro-[4-[[4-(4-octylcyclohexyl)phenyl]methoxy]phenyl]-λ6-sulfane |
| SMILES | CCCCCCCCC1CCC(c2ccc(COc3ccc(S(F)(F)(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H37F5OS/c1-2-3-4-5-6-7-8-22-9-13-24(14-10-22)25-15-11-23(12-16-25)21-33-26-17-19-27(20-18-26)34(28,29,30,31)32/h11-12,15-20,22,24H,2-10,13-14,21H2,1H3 |
| InChIKey | KVYSXBJNVIIUNY-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|