C23H27F5S — CID 25197320
pentafluoro-[4-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]phenyl]-λ6-sulfane (PubChem CID 25197320) has the molecular formula C23H27F5S and a molecular weight of 430.53 g/mol. Its IUPAC name is pentafluoro-[4-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 25197320 |
| Molecular Formula | C23H27F5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | pentafluoro-[4-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]phenyl]-λ6-sulfane |
| SMILES | CCCC1CCC(c2ccc(/C=C/c3ccc(S(F)(F)(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H27F5S/c1-2-3-18-6-12-21(13-7-18)22-14-8-19(9-15-22)4-5-20-10-16-23(17-11-20)29(24,25,26,27)28/h4-5,8-11,14-18,21H,2-3,6-7,12-13H2,1H3/b5-4+ |
| InChIKey | WNRQWHHIYZPDOR-SNAWJCMRSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|