C28H34F2 — CID 67699851
1-[(Z)-1,2-difluoro-2-[4-[(E)-pent-1-enyl]phenyl]ethenyl]-4-(4-propylcyclohexyl)benzene (PubChem CID 67699851) has the molecular formula C28H34F2 and a molecular weight of 408.58 g/mol. Its IUPAC name is 1-[(Z)-1,2-difluoro-2-[4-[(E)-pent-1-enyl]phenyl]ethenyl]-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-[(Z)-1,2-difluoro-2-[4-[(E)-pent-1-enyl]phenyl]ethenyl]-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 67699851 |
| Molecular Formula | C28H34F2 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-[(Z)-1,2-difluoro-2-[4-[(E)-pent-1-enyl]phenyl]ethenyl]-4-(4-propylcyclohexyl)benzene |
| SMILES | CCC/C=C/c1ccc(/C(F)=C(/F)c2ccc(C3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H34F2/c1-3-5-6-8-22-11-15-25(16-12-22)27(29)28(30)26-19-17-24(18-20-26)23-13-9-21(7-4-2)10-14-23/h6,8,11-12,15-21,23H,3-5,7,9-10,13-14H2,1-2H3/b8-6+,28-27- |
| InChIKey | XQAAXTKZXVSWFO-DRFHTFNYSA-N |
| XLogP | 9.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|