C23H27F — CID 22123950
1-(4-fluorocyclohexyl)-4-[4-[(E)-pent-1-enyl]phenyl]benzene (PubChem CID 22123950) has the molecular formula C23H27F and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-(4-fluorocyclohexyl)-4-[4-[(E)-pent-1-enyl]phenyl]benzene.
| Compound Name | 1-(4-fluorocyclohexyl)-4-[4-[(E)-pent-1-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 22123950 |
| Molecular Formula | C23H27F |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-(4-fluorocyclohexyl)-4-[4-[(E)-pent-1-enyl]phenyl]benzene |
| SMILES | CCC/C=C/c1ccc(-c2ccc(C3CCC(F)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H27F/c1-2-3-4-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-14-16-23(24)17-15-22/h4-13,22-23H,2-3,14-17H2,1H3/b5-4+ |
| InChIKey | TXPFYQQSUZMKKV-SNAWJCMRSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |