C26H32F2 — CID 22123874
1-(4,4-difluorocyclohexyl)-4-[4-[(E)-oct-1-enyl]phenyl]benzene (PubChem CID 22123874) has the molecular formula C26H32F2 and a molecular weight of 382.54 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4-[4-[(E)-oct-1-enyl]phenyl]benzene.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4-[4-[(E)-oct-1-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 22123874 |
| Molecular Formula | C26H32F2 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4-[4-[(E)-oct-1-enyl]phenyl]benzene |
| SMILES | CCCCCC/C=C/c1ccc(-c2ccc(C3CCC(F)(F)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H32F2/c1-2-3-4-5-6-7-8-21-9-11-22(12-10-21)23-13-15-24(16-14-23)25-17-19-26(27,28)20-18-25/h7-16,25H,2-6,17-20H2,1H3/b8-7+ |
| InChIKey | KAWLDAGBZHCXSB-BQYQJAHWSA-N |
| XLogP | 8.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|