C26H30F4 — CID 22123943
1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-oct-1-enyl]benzene (PubChem CID 22123943) has the molecular formula C26H30F4 and a molecular weight of 418.52 g/mol. Its IUPAC name is 1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-oct-1-enyl]benzene.
| Compound Name | 1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-oct-1-enyl]benzene |
|---|---|
| PubChem CID | 22123943 |
| Molecular Formula | C26H30F4 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 1-[4-(4,4-difluorocyclohexyl)phenyl]-2,3-difluoro-4-[(E)-oct-1-enyl]benzene |
| SMILES | CCCCCC/C=C/c1ccc(-c2ccc(C3CCC(F)(F)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H30F4/c1-2-3-4-5-6-7-8-22-13-14-23(25(28)24(22)27)21-11-9-19(10-12-21)20-15-17-26(29,30)18-16-20/h7-14,20H,2-6,15-18H2,1H3/b8-7+ |
| InChIKey | XKBLNLCDDYRXRA-BQYQJAHWSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|