C34H38F4 — CID 139688503
1-[4-[2,3-difluoro-4-[(E)-non-1-enyl]phenyl]buta-1,3-diynyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene (PubChem CID 139688503) has the molecular formula C34H38F4 and a molecular weight of 522.67 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[(E)-non-1-enyl]phenyl]buta-1,3-diynyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene.
| Compound Name | 1-[4-[2,3-difluoro-4-[(E)-non-1-enyl]phenyl]buta-1,3-diynyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene |
|---|---|
| PubChem CID | 139688503 |
| Molecular Formula | C34H38F4 |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[(E)-non-1-enyl]phenyl]buta-1,3-diynyl]-2,3-difluoro-4-[(E)-non-1-enyl]benzene |
| SMILES | CCCCCCC/C=C/c1ccc(C#CC#Cc2ccc(/C=C/CCCCCCC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C34H38F4/c1-3-5-7-9-11-13-15-19-27-23-25-29(33(37)31(27)35)21-17-18-22-30-26-24-28(32(36)34(30)38)20-16-14-12-10-8-6-4-2/h15-16,19-20,23-26H,3-14H2,1-2H3/b19-15+,20-16+ |
| InChIKey | DOBGTOUAQYRMAC-MXWIWYRXSA-N |
| XLogP | 10.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|