C32H36F2 — CID 139688497
2-fluoro-1-[4-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]buta-1,3-diynyl]-4-[(E)-oct-1-enyl]benzene (PubChem CID 139688497) has the molecular formula C32H36F2 and a molecular weight of 458.64 g/mol. Its IUPAC name is 2-fluoro-1-[4-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]buta-1,3-diynyl]-4-[(E)-oct-1-enyl]benzene.
| Compound Name | 2-fluoro-1-[4-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]buta-1,3-diynyl]-4-[(E)-oct-1-enyl]benzene |
|---|---|
| PubChem CID | 139688497 |
| Molecular Formula | C32H36F2 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 2-fluoro-1-[4-[2-fluoro-4-[(E)-oct-1-enyl]phenyl]buta-1,3-diynyl]-4-[(E)-oct-1-enyl]benzene |
| SMILES | CCCCCC/C=C/c1ccc(C#CC#Cc2ccc(/C=C/CCCCCC)cc2F)c(F)c1 |
| InChI | InChI=1S/C32H36F2/c1-3-5-7-9-11-13-17-27-21-23-29(31(33)25-27)19-15-16-20-30-24-22-28(26-32(30)34)18-14-12-10-8-6-4-2/h13-14,17-18,21-26H,3-12H2,1-2H3/b17-13+,18-14+ |
| InChIKey | NPSADNGAVAIDGC-HBKJEHTGSA-N |
| XLogP | 9.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|