C28H28F2 — CID 139688448
2-fluoro-4-[4-[3-fluoro-4-[(E)-hex-1-enyl]phenyl]buta-1,3-diynyl]-1-[(E)-hex-1-enyl]benzene (PubChem CID 139688448) has the molecular formula C28H28F2 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-fluoro-4-[4-[3-fluoro-4-[(E)-hex-1-enyl]phenyl]buta-1,3-diynyl]-1-[(E)-hex-1-enyl]benzene.
| Compound Name | 2-fluoro-4-[4-[3-fluoro-4-[(E)-hex-1-enyl]phenyl]buta-1,3-diynyl]-1-[(E)-hex-1-enyl]benzene |
|---|---|
| PubChem CID | 139688448 |
| Molecular Formula | C28H28F2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-fluoro-4-[4-[3-fluoro-4-[(E)-hex-1-enyl]phenyl]buta-1,3-diynyl]-1-[(E)-hex-1-enyl]benzene |
| SMILES | CCCC/C=C/c1ccc(C#CC#Cc2ccc(/C=C/CCCC)c(F)c2)cc1F |
| InChI | InChI=1S/C28H28F2/c1-3-5-7-9-15-25-19-17-23(21-27(25)29)13-11-12-14-24-18-20-26(28(30)22-24)16-10-8-6-4-2/h9-10,15-22H,3-8H2,1-2H3/b15-9+,16-10+ |
| InChIKey | DJULVTDWWOTDID-KAVGSWPWSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|