C28H32N2 — CID 139688463
2-[(E)-hept-1-enyl]-5-[4-[6-[(E)-hept-1-enyl]-3-pyridinyl]buta-1,3-diynyl]pyridine (PubChem CID 139688463) has the molecular formula C28H32N2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-[(E)-hept-1-enyl]-5-[4-[6-[(E)-hept-1-enyl]-3-pyridinyl]buta-1,3-diynyl]pyridine.
| Compound Name | 2-[(E)-hept-1-enyl]-5-[4-[6-[(E)-hept-1-enyl]-3-pyridinyl]buta-1,3-diynyl]pyridine |
|---|---|
| PubChem CID | 139688463 |
| Molecular Formula | C28H32N2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-[(E)-hept-1-enyl]-5-[4-[6-[(E)-hept-1-enyl]-3-pyridinyl]buta-1,3-diynyl]pyridine |
| SMILES | CCCCC/C=C/c1ccc(C#CC#Cc2ccc(/C=C/CCCCC)nc2)cn1 |
| InChI | InChI=1S/C28H32N2/c1-3-5-7-9-11-17-27-21-19-25(23-29-27)15-13-14-16-26-20-22-28(30-24-26)18-12-10-8-6-4-2/h11-12,17-24H,3-10H2,1-2H3/b17-11+,18-12+ |
| InChIKey | BHPQOMHCXYLQSC-JYFOCSDGSA-N |
| XLogP | 7.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|