C22H23F — CID 22922864
2-fluoro-4-[2-[4-[(E)-pent-1-enyl]phenyl]ethynyl]-1-propylbenzene (PubChem CID 22922864) has the molecular formula C22H23F and a molecular weight of 306.42 g/mol. Its IUPAC name is 2-fluoro-4-[2-[4-[(E)-pent-1-enyl]phenyl]ethynyl]-1-propylbenzene.
| Compound Name | 2-fluoro-4-[2-[4-[(E)-pent-1-enyl]phenyl]ethynyl]-1-propylbenzene |
|---|---|
| PubChem CID | 22922864 |
| Molecular Formula | C22H23F |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-fluoro-4-[2-[4-[(E)-pent-1-enyl]phenyl]ethynyl]-1-propylbenzene |
| SMILES | CCC/C=C/c1ccc(C#Cc2ccc(CCC)c(F)c2)cc1 |
| InChI | InChI=1S/C22H23F/c1-3-5-6-8-18-9-11-19(12-10-18)13-14-20-15-16-21(7-4-2)22(23)17-20/h6,8-12,15-17H,3-5,7H2,1-2H3/b8-6+ |
| InChIKey | YCCOEPVMJCMBOT-SOFGYWHQSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|