C24H30F2 — CID 22991673
1,3-difluoro-5-[4-[4-[(E)-pent-1-enyl]phenyl]butyl]-2-propylbenzene (PubChem CID 22991673) has the molecular formula C24H30F2 and a molecular weight of 356.50 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[4-[(E)-pent-1-enyl]phenyl]butyl]-2-propylbenzene.
| Compound Name | 1,3-difluoro-5-[4-[4-[(E)-pent-1-enyl]phenyl]butyl]-2-propylbenzene |
|---|---|
| PubChem CID | 22991673 |
| Molecular Formula | C24H30F2 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1,3-difluoro-5-[4-[4-[(E)-pent-1-enyl]phenyl]butyl]-2-propylbenzene |
| SMILES | CCC/C=C/c1ccc(CCCCc2cc(F)c(CCC)c(F)c2)cc1 |
| InChI | InChI=1S/C24H30F2/c1-3-5-6-10-19-13-15-20(16-14-19)11-7-8-12-21-17-23(25)22(9-4-2)24(26)18-21/h6,10,13-18H,3-5,7-9,11-12H2,1-2H3/b10-6+ |
| InChIKey | UQCVSSIOCSFHQC-UXBLZVDNSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|