C15H22O — CID 169454033
3-(4-hexylphenyl)prop-2-en-1-ol (PubChem CID 169454033) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-(4-hexylphenyl)prop-2-en-1-ol.
| Compound Name | 3-(4-hexylphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 169454033 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 3-(4-hexylphenyl)prop-2-en-1-ol |
| SMILES | CCCCCCc1ccc(C=CCO)cc1 |
| InChI | InChI=1S/C15H22O/c1-2-3-4-5-7-14-9-11-15(12-10-14)8-6-13-16/h6,8-12,16H,2-5,7,13H2,1H3 |
| InChIKey | ALVWIFDAWHMDJT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|