C19H31NO2 — CID 56948666
2-amino-2-[(Z)-2-(4-octylphenyl)ethenyl]propane-1,3-diol (PubChem CID 56948666) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2-amino-2-[(Z)-2-(4-octylphenyl)ethenyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[(Z)-2-(4-octylphenyl)ethenyl]propane-1,3-diol |
|---|---|
| PubChem CID | 56948666 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 2-amino-2-[(Z)-2-(4-octylphenyl)ethenyl]propane-1,3-diol |
| SMILES | CCCCCCCCc1ccc(/C=C\C(N)(CO)CO)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19(20,15-21)16-22/h9-14,21-22H,2-8,15-16,20H2,1H3/b14-13- |
| InChIKey | IRICXIZDBSGRCA-YPKPFQOOSA-N |
| XLogP | 3.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|