C19H35NO3 — CID 46203920
2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;hydrate (PubChem CID 46203920) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is 2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;hydrate.
| Compound Name | 2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;hydrate |
|---|---|
| PubChem CID | 46203920 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | 2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;hydrate |
| SMILES | CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.O |
| InChI | InChI=1S/C19H33NO2.H2O/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19(20,15-21)16-22;/h9-12,21-22H,2-8,13-16,20H2,1H3;1H2 |
| InChIKey | HZRIWIXBGWESRD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|