C23H36F3NO5 — CID 139025028
[2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butyl] acetate;2,2,2-trifluoroacetic acid (PubChem CID 139025028) has the molecular formula C23H36F3NO5 and a molecular weight of 463.54 g/mol. Its IUPAC name is [2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butyl] acetate;2,2,2-trifluoroacetic acid.
| Compound Name | [2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butyl] acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 139025028 |
| Molecular Formula | C23H36F3NO5 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | [2-amino-2-(hydroxymethyl)-4-(4-octylphenyl)butyl] acetate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCc1ccc(CCC(N)(CO)COC(C)=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H35NO3.C2HF3O2/c1-3-4-5-6-7-8-9-19-10-12-20(13-11-19)14-15-21(22,16-23)17-25-18(2)24;3-2(4,5)1(6)7/h10-13,23H,3-9,14-17,22H2,1-2H3;(H,6,7) |
| InChIKey | MEDXQDQGMFMDRA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|