C21H37NO4 — CID 46207226
acetic acid;2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol (PubChem CID 46207226) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is acetic acid;2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol.
| Compound Name | acetic acid;2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 46207226 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | acetic acid;2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol |
| SMILES | CC(=O)O.CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1 |
| InChI | InChI=1S/C19H33NO2.C2H4O2/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19(20,15-21)16-22;1-2(3)4/h9-12,21-22H,2-8,13-16,20H2,1H3;1H3,(H,3,4) |
| InChIKey | MGBLIHVJAWZEAM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|