C22H31NO2 — CID 143349364
2-amino-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]propane-1,3-diol (PubChem CID 143349364) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 143349364 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 2-amino-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethyl]propane-1,3-diol |
| SMILES | Cc1ccc(CCCCc2ccc(CCC(N)(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C22H31NO2/c1-18-6-8-19(9-7-18)4-2-3-5-20-10-12-21(13-11-20)14-15-22(23,16-24)17-25/h6-13,24-25H,2-5,14-17,23H2,1H3 |
| InChIKey | IKUQYDOLHDLGIY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|