C19H34ClNO2 — CID 45264761
2-amino-2-[3-(4-heptylphenyl)propyl]propane-1,3-diol;hydrochloride (PubChem CID 45264761) has the molecular formula C19H34ClNO2 and a molecular weight of 343.94 g/mol. Its IUPAC name is 2-amino-2-[3-(4-heptylphenyl)propyl]propane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-2-[3-(4-heptylphenyl)propyl]propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 45264761 |
| Molecular Formula | C19H34ClNO2 |
| Molecular Weight | 343.94 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-amino-2-[3-(4-heptylphenyl)propyl]propane-1,3-diol;hydrochloride |
| SMILES | CCCCCCCc1ccc(CCCC(N)(CO)CO)cc1.Cl |
| InChI | InChI=1S/C19H33NO2.ClH/c1-2-3-4-5-6-8-17-10-12-18(13-11-17)9-7-14-19(20,15-21)16-22;/h10-13,21-22H,2-9,14-16,20H2,1H3;1H |
| InChIKey | LRXLGERLVOFVEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.94 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|