C19H34NO4P — CID 101386529
[(2R)-2-amino-1-hydroxy-5-(4-octylphenyl)pentan-2-yl]phosphonic acid (PubChem CID 101386529) has the molecular formula C19H34NO4P and a molecular weight of 371.46 g/mol. Its IUPAC name is [(2R)-2-amino-1-hydroxy-5-(4-octylphenyl)pentan-2-yl]phosphonic acid.
| Compound Name | [(2R)-2-amino-1-hydroxy-5-(4-octylphenyl)pentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 101386529 |
| Molecular Formula | C19H34NO4P |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | [(2R)-2-amino-1-hydroxy-5-(4-octylphenyl)pentan-2-yl]phosphonic acid |
| SMILES | CCCCCCCCc1ccc(CCC[C@](N)(CO)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C19H34NO4P/c1-2-3-4-5-6-7-9-17-11-13-18(14-12-17)10-8-15-19(20,16-21)25(22,23)24/h11-14,21H,2-10,15-16,20H2,1H3,(H2,22,23,24)/t19-/m1/s1 |
| InChIKey | UTOSVYGEHYASCG-LJQANCHMSA-N |
| XLogP | 3.74 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|