C18H32ClNO2 — CID 45261202
2-amino-2-[2-(4-heptylphenyl)ethyl]propane-1,3-diol;hydrochloride (PubChem CID 45261202) has the molecular formula C18H32ClNO2 and a molecular weight of 329.91 g/mol. Its IUPAC name is 2-amino-2-[2-(4-heptylphenyl)ethyl]propane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-2-[2-(4-heptylphenyl)ethyl]propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 45261202 |
| Molecular Formula | C18H32ClNO2 |
| Molecular Weight | 329.91 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-amino-2-[2-(4-heptylphenyl)ethyl]propane-1,3-diol;hydrochloride |
| SMILES | CCCCCCCc1ccc(CCC(N)(CO)CO)cc1.Cl |
| InChI | InChI=1S/C18H31NO2.ClH/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)12-13-18(19,14-20)15-21;/h8-11,20-21H,2-7,12-15,19H2,1H3;1H |
| InChIKey | ZMHVFZNMKCLXQE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.91 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|