C23H39NO7 — CID 71498757
2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;2-hydroxybutanedioic acid (PubChem CID 71498757) has the molecular formula C23H39NO7 and a molecular weight of 441.57 g/mol. Its IUPAC name is 2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;2-hydroxybutanedioic acid.
| Compound Name | 2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 71498757 |
| Molecular Formula | C23H39NO7 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 2-amino-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol;2-hydroxybutanedioic acid |
| SMILES | CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C19H33NO2.C4H6O5/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19(20,15-21)16-22;5-2(4(8)9)1-3(6)7/h9-12,21-22H,2-8,13-16,20H2,1H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | IXEQUJWNDCXZIS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|