C21H36ClNO2 — CID 142628691
2-amino-1-chloro-2-[4-(4-octylphenyl)butyl]propane-1,3-diol (PubChem CID 142628691) has the molecular formula C21H36ClNO2 and a molecular weight of 369.98 g/mol. Its IUPAC name is 2-amino-1-chloro-2-[4-(4-octylphenyl)butyl]propane-1,3-diol.
| Compound Name | 2-amino-1-chloro-2-[4-(4-octylphenyl)butyl]propane-1,3-diol |
|---|---|
| PubChem CID | 142628691 |
| Molecular Formula | C21H36ClNO2 |
| Molecular Weight | 369.98 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 2-amino-1-chloro-2-[4-(4-octylphenyl)butyl]propane-1,3-diol |
| SMILES | CCCCCCCCc1ccc(CCCCC(N)(CO)C(O)Cl)cc1 |
| InChI | InChI=1S/C21H36ClNO2/c1-2-3-4-5-6-7-10-18-12-14-19(15-13-18)11-8-9-16-21(23,17-24)20(22)25/h12-15,20,24-25H,2-11,16-17,23H2,1H3 |
| InChIKey | BQWGRAGQWFFMIO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|