C23H32ClNO3 — CID 142628668
2-amino-1-chloro-2-[2-[4-(5-phenylpentoxymethyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 142628668) has the molecular formula C23H32ClNO3 and a molecular weight of 405.97 g/mol. Its IUPAC name is 2-amino-1-chloro-2-[2-[4-(5-phenylpentoxymethyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-1-chloro-2-[2-[4-(5-phenylpentoxymethyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 142628668 |
| Molecular Formula | C23H32ClNO3 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-amino-1-chloro-2-[2-[4-(5-phenylpentoxymethyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | NC(CO)(CCc1ccc(COCCCCCc2ccccc2)cc1)C(O)Cl |
| InChI | InChI=1S/C23H32ClNO3/c24-22(27)23(25,18-26)15-14-20-10-12-21(13-11-20)17-28-16-6-2-5-9-19-7-3-1-4-8-19/h1,3-4,7-8,10-13,22,26-27H,2,5-6,9,14-18,25H2 |
| InChIKey | QXMQHXIWCPLKFV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|