C16H26O5 — CID 131987442
2-(hydroxymethyl)-2-(4-phenylmethoxybutoxymethyl)propane-1,3-diol (PubChem CID 131987442) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(4-phenylmethoxybutoxymethyl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(4-phenylmethoxybutoxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 131987442 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-(hydroxymethyl)-2-(4-phenylmethoxybutoxymethyl)propane-1,3-diol |
| SMILES | OCC(CO)(CO)COCCCCOCc1ccccc1 |
| InChI | InChI=1S/C16H26O5/c17-11-16(12-18,13-19)14-21-9-5-4-8-20-10-15-6-2-1-3-7-15/h1-3,6-7,17-19H,4-5,8-14H2 |
| InChIKey | WXDYOLICOWTJDV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|