C24H42O5 — CID 118402269
3-[3-(3-deuteriopropoxy)-2,2-bis(3-deuteriopropoxymethyl)propoxy]propoxymethylbenzene (PubChem CID 118402269) has the molecular formula C24H42O5 and a molecular weight of 413.61 g/mol. Its IUPAC name is 3-[3-(3-deuteriopropoxy)-2,2-bis(3-deuteriopropoxymethyl)propoxy]propoxymethylbenzene.
| Compound Name | 3-[3-(3-deuteriopropoxy)-2,2-bis(3-deuteriopropoxymethyl)propoxy]propoxymethylbenzene |
|---|---|
| PubChem CID | 118402269 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | 3-[3-(3-deuteriopropoxy)-2,2-bis(3-deuteriopropoxymethyl)propoxy]propoxymethylbenzene |
| SMILES | [2H]CCCOCC(COCCC[2H])(COCCC[2H])COCCCOCc1ccccc1 |
| InChI | InChI=1S/C24H42O5/c1-4-13-26-19-24(20-27-14-5-2,21-28-15-6-3)22-29-17-10-16-25-18-23-11-8-7-9-12-23/h7-9,11-12H,4-6,10,13-22H2,1-3H3/i1D,2D,3D |
| InChIKey | NJDNRYCUDFLWDZ-CBYSEHNBSA-N |
| XLogP | 4.88 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|