C41H60N2O5 — CID 57436145
1-[4-[3,6-diamino-4,5-dihydroxy-3,6-bis(hydroxymethyl)-8-(4-octylphenyl)octyl]phenyl]-5-phenylpentan-1-one (PubChem CID 57436145) has the molecular formula C41H60N2O5 and a molecular weight of 660.94 g/mol. Its IUPAC name is 1-[4-[3,6-diamino-4,5-dihydroxy-3,6-bis(hydroxymethyl)-8-(4-octylphenyl)octyl]phenyl]-5-phenylpentan-1-one.
| Compound Name | 1-[4-[3,6-diamino-4,5-dihydroxy-3,6-bis(hydroxymethyl)-8-(4-octylphenyl)octyl]phenyl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 57436145 |
| Molecular Formula | C41H60N2O5 |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.45 |
| IUPAC Name | 1-[4-[3,6-diamino-4,5-dihydroxy-3,6-bis(hydroxymethyl)-8-(4-octylphenyl)octyl]phenyl]-5-phenylpentan-1-one |
| SMILES | CCCCCCCCc1ccc(CCC(N)(CO)C(O)C(O)C(N)(CO)CCc2ccc(C(=O)CCCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C41H60N2O5/c1-2-3-4-5-6-8-15-33-18-20-34(21-19-33)26-28-40(42,30-44)38(47)39(48)41(43,31-45)29-27-35-22-24-36(25-23-35)37(46)17-12-11-16-32-13-9-7-10-14-32/h7,9-10,13-14,18-25,38-39,44-45,47-48H,2-6,8,11-12,15-17,26-31,42-43H2,1H3 |
| InChIKey | GJHRBAFXJJQYOW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|