C19H33FNO4P — CID 54767032
[2-amino-2-((18F)fluoromethyl)-4-(4-octylphenyl)butyl] dihydrogen phosphate (PubChem CID 54767032) has the molecular formula C19H33FNO4P and a molecular weight of 388.45 g/mol. Its IUPAC name is [2-amino-2-((18F)fluoromethyl)-4-(4-octylphenyl)butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-((18F)fluoromethyl)-4-(4-octylphenyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54767032 |
| Molecular Formula | C19H33FNO4P |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [2-amino-2-((18F)fluoromethyl)-4-(4-octylphenyl)butyl] dihydrogen phosphate |
| SMILES | CCCCCCCCc1ccc(CCC(N)(C[18F])COP(=O)(O)O)cc1 |
| InChI | InChI=1S/C19H33FNO4P/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)13-14-19(21,15-20)16-25-26(22,23)24/h9-12H,2-8,13-16,21H2,1H3,(H2,22,23,24)/i20-1 |
| InChIKey | SZIPFUMBYAUCBV-LRFGSCOBSA-N |
| XLogP | 4.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|