C20H31FN3O3P — CID 71602841
[(E,3S)-3-azido-3-(fluoromethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid (PubChem CID 71602841) has the molecular formula C20H31FN3O3P and a molecular weight of 411.46 g/mol. Its IUPAC name is [(E,3S)-3-azido-3-(fluoromethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid.
| Compound Name | [(E,3S)-3-azido-3-(fluoromethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 71602841 |
| Molecular Formula | C20H31FN3O3P |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | [(E,3S)-3-azido-3-(fluoromethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid |
| SMILES | CCCCCCCCc1ccc(CC[C@](/C=C/P(=O)(O)O)(CF)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H31FN3O3P/c1-2-3-4-5-6-7-8-18-9-11-19(12-10-18)13-14-20(17-21,23-24-22)15-16-28(25,26)27/h9-12,15-16H,2-8,13-14,17H2,1H3,(H2,25,26,27)/b16-15+/t20-/m0/s1 |
| InChIKey | MBMZIIAGSNNZAJ-APHAIJBRSA-N |
| XLogP | 6.23 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|