C20H32N3O4P — CID 90317488
[(E)-3-azido-3-(hydroxymethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid (PubChem CID 90317488) has the molecular formula C20H32N3O4P and a molecular weight of 409.47 g/mol. Its IUPAC name is [(E)-3-azido-3-(hydroxymethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid.
| Compound Name | [(E)-3-azido-3-(hydroxymethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 90317488 |
| Molecular Formula | C20H32N3O4P |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [(E)-3-azido-3-(hydroxymethyl)-5-(4-octylphenyl)pent-1-enyl]phosphonic acid |
| SMILES | CCCCCCCCc1ccc(CCC(/C=C/P(=O)(O)O)(CO)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H32N3O4P/c1-2-3-4-5-6-7-8-18-9-11-19(12-10-18)13-14-20(17-24,22-23-21)15-16-28(25,26)27/h9-12,15-16,24H,2-8,13-14,17H2,1H3,(H2,25,26,27)/b16-15+ |
| InChIKey | IUICHFFRDGVCQT-FOCLMDBBSA-N |
| XLogP | 5.26 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|