C22H41NO2 — CID 144607941
ethane;2-(methylamino)-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol (PubChem CID 144607941) has the molecular formula C22H41NO2 and a molecular weight of 351.58 g/mol. Its IUPAC name is ethane;2-(methylamino)-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol.
| Compound Name | ethane;2-(methylamino)-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 144607941 |
| Molecular Formula | C22H41NO2 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.31 |
| IUPAC Name | ethane;2-(methylamino)-2-[2-(4-octylphenyl)ethyl]propane-1,3-diol |
| SMILES | CC.CCCCCCCCc1ccc(CCC(CO)(CO)NC)cc1 |
| InChI | InChI=1S/C20H35NO2.C2H6/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)14-15-20(16-22,17-23)21-2;1-2/h10-13,21-23H,3-9,14-17H2,1-2H3;1-2H3 |
| InChIKey | SNACHUHPECLAPJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|