C20H36NO6P — CID 23249406
[2-amino-2-[2-(4-heptoxyphenyl)ethyl]-5-hydroxypentyl] dihydrogen phosphate (PubChem CID 23249406) has the molecular formula C20H36NO6P and a molecular weight of 417.48 g/mol. Its IUPAC name is [2-amino-2-[2-(4-heptoxyphenyl)ethyl]-5-hydroxypentyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-[2-(4-heptoxyphenyl)ethyl]-5-hydroxypentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23249406 |
| Molecular Formula | C20H36NO6P |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [2-amino-2-[2-(4-heptoxyphenyl)ethyl]-5-hydroxypentyl] dihydrogen phosphate |
| SMILES | CCCCCCCOc1ccc(CCC(N)(CCCO)COP(=O)(O)O)cc1 |
| InChI | InChI=1S/C20H36NO6P/c1-2-3-4-5-6-16-26-19-10-8-18(9-11-19)12-14-20(21,13-7-15-22)17-27-28(23,24)25/h8-11,22H,2-7,12-17,21H2,1H3,(H2,23,24,25) |
| InChIKey | GPVCTCOMFMUXFX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|