C21H30F2NO6P — CID 46885916
[2-amino-4-[4-(4-butoxy-2-fluorophenyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate;hydrofluoride (PubChem CID 46885916) has the molecular formula C21H30F2NO6P and a molecular weight of 461.44 g/mol. Its IUPAC name is [2-amino-4-[4-(4-butoxy-2-fluorophenyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate;hydrofluoride.
| Compound Name | [2-amino-4-[4-(4-butoxy-2-fluorophenyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate;hydrofluoride |
|---|---|
| PubChem CID | 46885916 |
| Molecular Formula | C21H30F2NO6P |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [2-amino-4-[4-(4-butoxy-2-fluorophenyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate;hydrofluoride |
| SMILES | CCCCOc1ccc(-c2ccc(CCC(N)(CO)COP(=O)(O)O)cc2)c(F)c1.F |
| InChI | InChI=1S/C21H29FNO6P.FH/c1-2-3-12-28-18-8-9-19(20(22)13-18)17-6-4-16(5-7-17)10-11-21(23,14-24)15-29-30(25,26)27;/h4-9,13,24H,2-3,10-12,14-15,23H2,1H3,(H2,25,26,27);1H |
| InChIKey | FWSQKUFKMUUSSA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|