C20H29NO3 — CID 58709703
2-amino-2-[2-(6-pentoxynaphthalen-2-yl)ethyl]propane-1,3-diol (PubChem CID 58709703) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-amino-2-[2-(6-pentoxynaphthalen-2-yl)ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-(6-pentoxynaphthalen-2-yl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 58709703 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-amino-2-[2-(6-pentoxynaphthalen-2-yl)ethyl]propane-1,3-diol |
| SMILES | CCCCCOc1ccc2cc(CCC(N)(CO)CO)ccc2c1 |
| InChI | InChI=1S/C20H29NO3/c1-2-3-4-11-24-19-8-7-17-12-16(5-6-18(17)13-19)9-10-20(21,14-22)15-23/h5-8,12-13,22-23H,2-4,9-11,14-15,21H2,1H3 |
| InChIKey | XIKHAJDAKWVODA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|