C22H32ClNO3 — CID 46205130
2-amino-2-[2-[4-(4-butoxy-2-methylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride (PubChem CID 46205130) has the molecular formula C22H32ClNO3 and a molecular weight of 393.96 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(4-butoxy-2-methylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-2-[2-[4-(4-butoxy-2-methylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 46205130 |
| Molecular Formula | C22H32ClNO3 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-amino-2-[2-[4-(4-butoxy-2-methylphenyl)phenyl]ethyl]propane-1,3-diol;hydrochloride |
| SMILES | CCCCOc1ccc(-c2ccc(CCC(N)(CO)CO)cc2)c(C)c1.Cl |
| InChI | InChI=1S/C22H31NO3.ClH/c1-3-4-13-26-20-9-10-21(17(2)14-20)19-7-5-18(6-8-19)11-12-22(23,15-24)16-25;/h5-10,14,24-25H,3-4,11-13,15-16,23H2,1-2H3;1H |
| InChIKey | HVGGMVMSAQBWHN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|