C20H35NO2 — CID 132916636
(2S)-2-amino-2-methyl-4-(4-nonoxyphenyl)butan-1-ol (PubChem CID 132916636) has the molecular formula C20H35NO2 and a molecular weight of 321.50 g/mol. Its IUPAC name is (2S)-2-amino-2-methyl-4-(4-nonoxyphenyl)butan-1-ol.
| Compound Name | (2S)-2-amino-2-methyl-4-(4-nonoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 132916636 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (2S)-2-amino-2-methyl-4-(4-nonoxyphenyl)butan-1-ol |
| SMILES | CCCCCCCCCOc1ccc(CC[C@](C)(N)CO)cc1 |
| InChI | InChI=1S/C20H35NO2/c1-3-4-5-6-7-8-9-16-23-19-12-10-18(11-13-19)14-15-20(2,21)17-22/h10-13,22H,3-9,14-17,21H2,1-2H3/t20-/m0/s1 |
| InChIKey | JCFHWXOPODYSKO-FQEVSTJZSA-N |
| XLogP | 4.46 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|