C20H33NO3 — CID 11772019
(4R)-4-amino-6-(4-heptoxyphenyl)-4-methylhexanoic acid (PubChem CID 11772019) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is (4R)-4-amino-6-(4-heptoxyphenyl)-4-methylhexanoic acid.
| Compound Name | (4R)-4-amino-6-(4-heptoxyphenyl)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 11772019 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | (4R)-4-amino-6-(4-heptoxyphenyl)-4-methylhexanoic acid |
| SMILES | CCCCCCCOc1ccc(CC[C@@](C)(N)CCC(=O)O)cc1 |
| InChI | InChI=1S/C20H33NO3/c1-3-4-5-6-7-16-24-18-10-8-17(9-11-18)12-14-20(2,21)15-13-19(22)23/h8-11H,3-7,12-16,21H2,1-2H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | DGAGMTJLEUOLJC-HXUWFJFHSA-N |
| XLogP | 4.55 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|