C18H30ClNO3 — CID 23121390
3-[3-(4-hexoxyphenyl)propylamino]propanoic acid;hydrochloride (PubChem CID 23121390) has the molecular formula C18H30ClNO3 and a molecular weight of 343.90 g/mol. Its IUPAC name is 3-[3-(4-hexoxyphenyl)propylamino]propanoic acid;hydrochloride.
| Compound Name | 3-[3-(4-hexoxyphenyl)propylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 23121390 |
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-[3-(4-hexoxyphenyl)propylamino]propanoic acid;hydrochloride |
| SMILES | CCCCCCOc1ccc(CCCNCCC(=O)O)cc1.Cl |
| InChI | InChI=1S/C18H29NO3.ClH/c1-2-3-4-5-15-22-17-10-8-16(9-11-17)7-6-13-19-14-12-18(20)21;/h8-11,19H,2-7,12-15H2,1H3,(H,20,21);1H |
| InChIKey | KIJIJHZFRJUYFI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|