C27H31NO3 — CID 23121607
3-[3-[4-(3,3-diphenylpropoxy)phenyl]propylamino]propanoic acid (PubChem CID 23121607) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-[3-[4-(3,3-diphenylpropoxy)phenyl]propylamino]propanoic acid.
| Compound Name | 3-[3-[4-(3,3-diphenylpropoxy)phenyl]propylamino]propanoic acid |
|---|---|
| PubChem CID | 23121607 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 3-[3-[4-(3,3-diphenylpropoxy)phenyl]propylamino]propanoic acid |
| SMILES | O=C(O)CCNCCCc1ccc(OCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO3/c29-27(30)17-20-28-19-7-8-22-13-15-25(16-14-22)31-21-18-26(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-6,9-16,26,28H,7-8,17-21H2,(H,29,30) |
| InChIKey | LQYJNHICEBLRFU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|