C20H24F3NO5S — CID 23121691
3-[3-[4-(2-thiophen-2-ylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 23121691) has the molecular formula C20H24F3NO5S and a molecular weight of 447.48 g/mol. Its IUPAC name is 3-[3-[4-(2-thiophen-2-ylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-[4-(2-thiophen-2-ylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23121691 |
| Molecular Formula | C20H24F3NO5S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 3-[3-[4-(2-thiophen-2-ylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCNCCCc1ccc(OCCc2cccs2)cc1 |
| InChI | InChI=1S/C18H23NO3S.C2HF3O2/c20-18(21)9-12-19-11-1-3-15-5-7-16(8-6-15)22-13-10-17-4-2-14-23-17;3-2(4,5)1(6)7/h2,4-8,14,19H,1,3,9-13H2,(H,20,21);(H,6,7) |
| InChIKey | UCQSZOCAQUNKOX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|