C27H31NO4 — CID 23121054
3-[3-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]propylamino]propanoic acid (PubChem CID 23121054) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[3-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]propylamino]propanoic acid.
| Compound Name | 3-[3-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]propylamino]propanoic acid |
|---|---|
| PubChem CID | 23121054 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 3-[3-[4-[2-(4-phenylmethoxyphenyl)ethoxy]phenyl]propylamino]propanoic acid |
| SMILES | O=C(O)CCNCCCc1ccc(OCCc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H31NO4/c29-27(30)16-19-28-18-4-7-22-8-12-25(13-9-22)31-20-17-23-10-14-26(15-11-23)32-21-24-5-2-1-3-6-24/h1-3,5-6,8-15,28H,4,7,16-21H2,(H,29,30) |
| InChIKey | OAORKOKSJVRULA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|